Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 2'-Deoxy-2'-Fluororibose |
|---|---|
| Synonyms | (2R,3R,4R)-2-Fluoro-3,4,5-Trihydroxy-Pentanal; (2R,3R,4R)-2-Fluoro-3,4,5-Trihydroxy-Valeraldehyde; D-Ribose, 2-Deoxy-2-Fluoro- |
| Molecular Structure |  |
| Molecular Formula | C5H9FO4 |
| Molecular Weight | 152.12 |
| CAS Registry Number | 7226-33-7 |
| SMILES | [C@@H](C=O)(F)[C@H](O)[C@H](O)CO |
| InChI | 1S/C5H9FO4/c6-3(1-7)5(10)4(9)2-8/h1,3-5,8-10H,2H2/t3-,4+,5-/m0/s1 |
| InChIKey | NJYXSKVOTDPOAT-LMVFSUKVSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.114°C at 760 mmHg (Cal.) |
| Flash point | 197.596°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-Deoxy-2'-Fluororibose |