Online Database of Chemicals from Around the World
|
CAS#: 7240-15-5 Product: 4,4-Dimethyl-delta(8)-Cholestenol No suppilers available for the product. |
| Name | 4,4-Dimethyl-delta(8)-Cholestenol |
|---|---|
| Synonyms | (3S,10S,13R,14R,17R)-17-[(1R)-1,5-Dimethylhexyl]-4,4,10,13-Tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-Ol; 4,4-Dimethyl-Delta(8)-Cholestenol; Cholest-8-En-3-Ol, 4,4-Dimethyl-, (3Beta)- |
| Molecular Structure |  |
| Molecular Formula | C29H50O |
| Molecular Weight | 414.71 |
| CAS Registry Number | 7240-15-5 |
| SMILES | [C@]34([C@H](C2=C([C@@]1(C(C([C@@H](O)CC1)(C)C)CC2)C)CC3)CC[C@@H]4[C@@H](CCCC(C)C)C)C |
| InChI | 1S/C29H50O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h19-20,22-23,25-26,30H,8-18H2,1-7H3/t20-,22-,23+,25?,26+,28-,29-/m1/s1 |
| InChIKey | FYHRVINOXYETMN-LCHSQBAESA-N |
| Density | 0.98g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.929°C at 760 mmHg (Cal.) |
| Flash point | 217.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-delta(8)-Cholestenol |