Online Database of Chemicals from Around the World
|
CAS#: 72438-09-6 Product: 1,5-Dimethyl-2,3,6,7-Tetrahydro-1H,5H-Biscyclopentapyrazine No suppilers available for the product. |
| Name | 1,5-Dimethyl-2,3,6,7-Tetrahydro-1H,5H-Biscyclopentapyrazine |
|---|---|
| Synonyms | 1,5-Dtbcp; Dicyclopenta(B,E)Pyrazine, 1,2,3,5,6,7-Hexahydro-1,5-Dimethyl-, Trans-; 1,5(Or 7)-Dimethyl-2,3,6,7-Tetrahydro-1H,5H-Biscyclopentapyrazine |
| Molecular Structure |  |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 |
| CAS Registry Number | 72438-09-6 |
| SMILES | CC3C1=C(N=C2C(=N1)CCC2C)CC3 |
| InChI | 1S/C12H16N2/c1-7-3-5-9-11(7)13-10-6-4-8(2)12(10)14-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | AVQZINQGRAICIR-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.608°C at 760 mmHg (Cal.) |
| Flash point | 106.435°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethyl-2,3,6,7-Tetrahydro-1H,5H-Biscyclopentapyrazine |