Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-Benzofuran-2-Carboximidamide |
|---|---|
| Synonyms | Benzofuran-2-Carboxamidine; 2-Benzofurancarboxamidine; 2-Benzofurancarboximidamide |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 |
| CAS Registry Number | 72583-87-0 |
| SMILES | C1=C(OC2=CC=CC=C12)C(=N)N |
| InChI | 1S/C9H8N2O/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H,(H3,10,11) |
| InChIKey | PDECXGQFPNZGGZ-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.251°C at 760 mmHg (Cal.) |
| Flash point | 125.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzofuran-2-Carboximidamide |