Online Database of Chemicals from Around the World
|
CAS#: 7269-57-0 Product: Guanine Oxime No suppilers available for the product. |
| Name | Guanine Oxime |
|---|---|
| Synonyms | 1H-Purine-2,6-Diamine, N6-Hydroxy- (9Ci); 2-Amino-6-Hydroxyaminopurine; 1H-Purine-2,6-Diamine, N6-Hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C5H6N6O |
| Molecular Weight | 166.14 |
| CAS Registry Number | 7269-57-0 |
| SMILES | C1=NC2=C([NH]1)C(=NC(=N2)N)NO |
| InChI | 1S/C5H6N6O/c6-5-9-3-2(7-1-8-3)4(10-5)11-12/h1,12H,(H4,6,7,8,9,10,11) |
| InChIKey | UJUHACUYECLPGK-UHFFFAOYSA-N |
| Density | 1.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 781.202°C at 760 mmHg (Cal.) |
| Flash point | 426.256°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Guanine Oxime |