|
CAS#: 727371-69-9 Product: [2,2'-Bipyridine-4,4'-diylbis(oxy-4,1-phenylene)]dimethanamine No suppilers available for the product. |
| Name | [2,2'-Bipyridine-4,4'-diylbis(oxy-4,1-phenylene)]dimethanamine |
|---|---|
| Synonyms | BENZENEME |
| Molecular Structure | ![]() |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.46 |
| CAS Registry Number | 727371-69-9 |
| SMILES | n2ccc(Oc1ccc(cc1)CN)cc2c4nccc(Oc3ccc(cc3)CN)c4 |
| InChI | 1S/C24H22N4O2/c25-15-17-1-5-19(6-2-17)29-21-9-11-27-23(13-21)24-14-22(10-12-28-24)30-20-7-3-18(16-26)4-8-20/h1-14H,15-16,25-26H2 |
| InChIKey | JJYJWDXZKVRDGT-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.947°C at 760 mmHg (Cal.) |
| Flash point | 319.66°C (Cal.) |
| Refractive index | 1.645 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2,2'-Bipyridine-4,4'-diylbis(oxy-4,1-phenylene)]dimethanamine |