Online Database of Chemicals from Around the World
|
CAS#: 72741-90-3 Product: Securinegine No suppilers available for the product. |
| Name | Securinegine |
|---|---|
| Synonyms | 4,6-Ethenopyrano(2,3-I)Indolizin-2(4Ah)-One, 5,6,8,9,10,11-Hexahydro- |
| Molecular Structure |  |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 |
| CAS Registry Number | 72741-90-3 |
| SMILES | O=C1OC24N(C3C=CC(=C1)C2C3)CCCC4 |
| InChI | 1S/C13H15NO2/c15-12-7-9-3-4-10-8-11(9)13(16-12)5-1-2-6-14(10)13/h3-4,7,10-11H,1-2,5-6,8H2 |
| InChIKey | WRDRGEDNNRSUNY-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.331°C at 760 mmHg (Cal.) |
| Flash point | 196.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Securinegine |