Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[(1S,2R)-2-Aminocyclopropyl]phenol |
|---|---|
| Synonyms | 4-((1S,2R)-2-aminocyclopropyl)phenol; 4-Hydroxytranylcypromine; Phenol, 4-(2-aminocyclopropyl)-, trans- |
| Molecular Structure | ![CAS#: 727649-20-9， 4-[(1S,2R)-2-Aminocyclopropyl]phenol](/moreStructures/727649-20-9.gif) |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 |
| CAS Registry Number | 727649-20-9 |
| SMILES | Oc1ccc(cc1)[C@@H]2C[C@H]2N |
| InChI | 1S/C9H11NO/c10-9-5-8(9)6-1-3-7(11)4-2-6/h1-4,8-9,11H,5,10H2/t8-,9+/m0/s1 |
| InChIKey | HADIWKXZWHXEDX-DTWKUNHWSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.244°C at 760 mmHg (Cal.) |
| Flash point | 129.335°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(1S,2R)-2-Aminocyclopropyl]phenol |