Online Database of Chemicals from Around the World
|
CAS#: 72845-35-3 Product: (E,2S)-2,6-Dimethyloct-5-Enal No suppilers available for the product. |
| Name | (E,2S)-2,6-Dimethyloct-5-Enal |
|---|---|
| Synonyms | 5-Octenal, 2,6-Dimethyl-; 2,6-Dimethyl-5-Octenal |
| Molecular Structure |  |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 72845-35-3 |
| SMILES | [C@H](C=O)(C)CC\C=C(C)\CC |
| InChI | 1S/C10H18O/c1-4-9(2)6-5-7-10(3)8-11/h6,8,10H,4-5,7H2,1-3H3/b9-6+/t10-/m0/s1 |
| InChIKey | RMPKHUJAYKUKPH-ZKXNXJMVSA-N |
| Density | 0.835g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.994°C at 760 mmHg (Cal.) |
| Flash point | 75.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E,2S)-2,6-Dimethyloct-5-Enal |