| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl chloride |
|---|---|
| Synonyms | MFCD00155946; Perfluoro(2-methyl-3-oxahexanoyl) chloride; Perfluoromethyloxahexanoyl chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6ClF11O2 |
| Molecular Weight | 348.50 |
| CAS Registry Number | 72848-57-8 |
| SMILES | FC(F)(C(F)(F)OC(F)(C(Cl)=O)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C6ClF11O2/c7-1(19)2(8,4(11,12)13)20-6(17,18)3(9,10)5(14,15)16 |
| InChIKey | KLAVPNKIYBZAOK-UHFFFAOYSA-N |
| Density | 1.72g/cm3 (Cal.) |
|---|---|
| Boiling point | 73-74°C (Expl.) |
| 129.459°C at 760 mmHg (Cal.) | |
| Flash point | 26°C (Cal.) |
| Safety Description | Corrosive/Irritant/Moisture Sensitive |
|---|---|
| R34,R36/37/38 | |
| S3/7,S23,S24/25,S26,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl chloride |