|
CAS#: 72863-11-7 Product: 2-Propenoic acid polymer with ethyl 2-propenoate ammonium salt No suppilers available for the product. |
| Name | 2-Propenoic acid polymer with ethyl 2-propenoate ammonium salt |
|---|---|
| Synonyms | Acrylic Acid; Ammonia; Ethyl Prop-2-Enoate; Acrylic Acid; Ammonia; Prop-2-Enoic Acid Ethyl Ester |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 72863-11-7 |
| SMILES | C(OC(C=C)=O)C.O=C(C=C)O.N |
| InChI | 1S/C5H8O2.C3H4O2.H3N/c1-3-5(6)7-4-2;1-2-3(4)5;/h3H,1,4H2,2H3;2H,1H2,(H,4,5);1H3 |
| InChIKey | VNUDNQYYVXMVJL-UHFFFAOYSA-N |
| Boiling point | 99.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 15.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propenoic acid polymer with ethyl 2-propenoate ammonium salt |