Online Database of Chemicals from Around the World
|
CAS#: 7296-60-8 Product: beta-D-Ribopyranose No suppilers available for the product. |
| Name | beta-D-Ribopyranose |
|---|---|
| Synonyms | (2R,3R,4R,5R)-tetrahydro-2H-pyran-2,3,4,5-tetraol; PH7; Ribose |
| Molecular Structure |  |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 7296-60-8 |
| SMILES | C1[C@H]([C@H]([C@H]([C@@H](O1)O)O)O)O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-TXICZTDVSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 155.3±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-D-Ribopyranose |