Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | alpha,alpha-Dimethyl-4-Methylenecyclohexanemethanol |
|---|---|
| Synonyms | 2-(4-Methylenecyclohexyl)Propan-2-Ol; .Delta.-Terpineol |
| Molecular Structure |  |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 7299-42-5 |
| EINECS | 230-739-6 |
| SMILES | CC([CH]1CC[C](CC1)=[CH2])(O)C |
| InChI | 1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h9,11H,1,4-7H2,2-3H3 |
| InChIKey | SQIFACVGCPWBQZ-UHFFFAOYSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.598°C at 760 mmHg (Cal.) |
| Flash point | 83.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha-Dimethyl-4-Methylenecyclohexanemethanol |