|
CAS#: 73000-03-0 Product: Chloro(methyl)(2-methyl-2-propanyl)(pentafluorophenyl)silane No suppilers available for the product. |
| Name | Chloro(methyl)(2-methyl-2-propanyl)(pentafluorophenyl)silane |
|---|---|
| Synonyms | Silane, chloro(1,1-dimethylethyl)methyl(pentafluorophenyl)-; t-Butylpentafluorophenylmethylchlorosilane; tert-Butyl(chloro)methyl(2,3,4,5,6-pentafluorophenyl)silane |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClF5Si |
| Molecular Weight | 302.74 |
| CAS Registry Number | 73000-03-0 |
| EINECS | 277-196-1 |
| SMILES | Fc1c(F)c(F)c(F)c(F)c1[Si](Cl)(C(C)(C)C)C |
| InChI | 1S/C11H12ClF5Si/c1-11(2,3)18(4,12)10-8(16)6(14)5(13)7(15)9(10)17/h1-4H3 |
| InChIKey | DHPRJMARRBZSIZ-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.755°C at 760 mmHg (Cal.) |
| Flash point | 100.615°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloro(methyl)(2-methyl-2-propanyl)(pentafluorophenyl)silane |