Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[2-(Isopropylamino)-1-(methylamino)ethyl]-1,2-benzenediol |
|---|---|
| Synonyms | 4-(2-(isopropylamino)-1-(methylamino)ethyl)benzene-1,2-diol |
| Molecular Structure | ![CAS#: 730234-53-4， 4-[2-(Isopropylamino)-1-(methylamino)ethyl]-1,2-benzenediol](/moreStructures/730234-53-4.gif) |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 |
| CAS Registry Number | 730234-53-4 |
| SMILES | CC(C)NCC(c1ccc(c(c1)O)O)NC |
| InChI | 1S/C12H20N2O2/c1-8(2)14-7-10(13-3)9-4-5-11(15)12(16)6-9/h4-6,8,10,13-16H,7H2,1-3H3 |
| InChIKey | IBZSVRUEFXARLU-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.76°C at 760 mmHg (Cal.) |
| Flash point | 136.913°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(Isopropylamino)-1-(methylamino)ethyl]-1,2-benzenediol |