|
CAS#: 7313-86-2 Product: 10-(Cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol No suppilers available for the product. |
| Name | 10-(Cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol |
|---|---|
| Synonyms | (-)-Cyclazocine; (2α,6α,11 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 |
| CAS Registry Number | 7313-86-2 |
| SMILES | CC1C2CC3=C(C1(CCN2CC4CC4)C)C=C(C=C3)O |
| InChI | 1S/C18H25NO/c1-12-17-9-14-5-6-15(20)10-16(14)18(12,2)7-8-19(17)11-13-3-4-13/h5-6,10,12-13,17,20H,3-4,7-9,11H2,1-2H3 |
| InChIKey | YQYVFVRQLZMJKJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 188.7±26.5°C (Cal.) |
| (1) | Suwatchai Jarussophon, Stephane Acoca, Jin-Ming Gao, Christophe Deprez, Taira Kiyota, Cristina Draghici, Enrico Purisima and Yasuo Konishi. Automated molecular formula determination by tandem mass spectrometry (MS/MS), Analyst, 2009, 134, 690. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 10-(Cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol |