Online Database of Chemicals from Around the World
| Name | (4-Nitrophenyl) Methyldisulfanylformate |
|---|---|
| Synonyms | Methyldisulfanylformic Acid (4-Nitrophenyl) Ester; (4-Nitrophenyl) Methyldisulfanylmethanoate; 4-Nitrophenoxycarbonyl Methyl Disulfide |
| Molecular Structure |  |
| Molecular Formula | C8H7NO4S2 |
| Molecular Weight | 245.27 |
| CAS Registry Number | 73143-98-3 |
| SMILES | C1=C(OC(SSC)=O)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C8H7NO4S2/c1-14-15-8(10)13-7-4-2-6(3-5-7)9(11)12/h2-5H,1H3 |
| InChIKey | JVECEBGZXGYNGE-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.681°C at 760 mmHg (Cal.) |
| Flash point | 191.891°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Nitrophenyl) Methyldisulfanylformate |
