Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | beta-Methylbenzenebutyric Acid |
|---|---|
| Synonyms | 3-Methyl-4-Phenyl-Butanoic Acid; 3-Methyl-4-Phenyl-Butyric Acid; Benzenebutanoic Acid, .Beta.-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 7315-68-6 |
| SMILES | C1=CC=C(C=C1)CC(C)CC(=O)O |
| InChI | 1S/C11H14O2/c1-9(8-11(12)13)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13) |
| InChIKey | CJBVVZBGGFKPDA-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.267°C at 760 mmHg (Cal.) |
| Flash point | 195.395°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Methylbenzenebutyric Acid |