Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Acetamido-4-Hydroxyanthraquinone |
|---|---|
| Synonyms | N-(4-Hydroxy-9,10-Dioxo-1-Anthryl)Acetamide; N-(4-Hydroxy-9,10-Diketo-1-Anthryl)Acetamide; N-(4-Hydroxy-9,10-Dioxo-Anthracen-1-Yl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 |
| CAS Registry Number | 7323-62-8 |
| SMILES | C3=C(C1=C(C(C2=C(C1=O)C=CC=C2)=O)C(=C3)O)NC(C)=O |
| InChI | 1S/C16H11NO4/c1-8(18)17-11-6-7-12(19)14-13(11)15(20)9-4-2-3-5-10(9)16(14)21/h2-7,19H,1H3,(H,17,18) |
| InChIKey | VPZXLTVIBKOBRG-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Melting point | 198°C (Expl.) |
| Boiling point | 577.228°C at 760 mmHg (Cal.) |
| Flash point | 302.897°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Acetamido-4-Hydroxyanthraquinone |