Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | O-Methyl (chlorocarbonyl)phenylcarbamothioate |
|---|---|
| Synonyms | O-methyl chlorocarbonyl(phenyl)carbamothioate |
| Molecular Structure |  |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.68 |
| CAS Registry Number | 73280-66-7 |
| SMILES | COC(=S)N(C1=CC=CC=C1)C(=O)Cl |
| InChI | 1S/C9H8ClNO2S/c1-13-9(14)11(8(10)12)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | HSCLREPHCBWFCD-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.3±23.0°C at 760 mmHg (Cal.) |
| Flash point | 133.0±22.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Methyl (chlorocarbonyl)phenylcarbamothioate |