Online Database of Chemicals from Around the World
|
CAS#: 7331-20-6 Product: 5-(4-Chlorophenoxy)Pyrimidine-2,4-Diamine No suppilers available for the product. |
| Name | 5-(4-Chlorophenoxy)Pyrimidine-2,4-Diamine |
|---|---|
| Synonyms | [2-Amino-5-(4-Chlorophenoxy)Pyrimidin-4-Yl]Amine; 2,4-Diamino-5-(P-Chlorophenoxy)Pyrimidine; 5-25-12-00568 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 |
| CAS Registry Number | 7331-20-6 |
| SMILES | C1=NC(=NC(=C1OC2=CC=C(C=C2)Cl)N)N |
| InChI | 1S/C10H9ClN4O/c11-6-1-3-7(4-2-6)16-8-5-14-10(13)15-9(8)12/h1-5H,(H4,12,13,14,15) |
| InChIKey | APTANHMYYZPGNW-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.449°C at 760 mmHg (Cal.) |
| Flash point | 227.433°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Chlorophenoxy)Pyrimidine-2,4-Diamine |