Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-(Chloromethyl)-4-Formamidobenzoic Acid |
|---|---|
| Synonyms | 3-(Chloromethyl)-4-Formamido-Benzoic Acid; 3-(Chloromethyl)-4-(Formylamino)Benzoic Acid; Acidul 3-Clormetilen-4-Formilaminobenzoic [Romanian] |
| Molecular Structure |  |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 |
| CAS Registry Number | 73348-41-1 |
| SMILES | C1=C(C(=CC=C1C(=O)O)NC=O)CCl |
| InChI | 1S/C9H8ClNO3/c10-4-7-3-6(9(13)14)1-2-8(7)11-5-12/h1-3,5H,4H2,(H,11,12)(H,13,14) |
| InChIKey | PEKPPMAMLZHDRV-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.431°C at 760 mmHg (Cal.) |
| Flash point | 255.242°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Chloromethyl)-4-Formamidobenzoic Acid |