Online Database of Chemicals from Around the World
|
CAS#: 73384-68-6 Product: 4,8-Diamino-2,6-Dibromo-1,5-Naphthoquinone No suppilers available for the product. |
| Name | 4,8-Diamino-2,6-Dibromo-1,5-Naphthoquinone |
|---|---|
| Synonyms | 4,8-Diamino-2,6-Dibromo-Naphthalene-1,5-Dione; 4,8-Diamino-2,6-Dibromo-Naphthalene-1,5-Quinone; 8-Amino-2,6-Dibromo-5-Hydroxy-4-Imino-1(4H)-Naphthalenone |
| Molecular Structure |  |
| Molecular Formula | C10H6Br2N2O2 |
| Molecular Weight | 345.98 |
| CAS Registry Number | 73384-68-6 (26846-51-5) |
| EINECS | 277-410-3 |
| SMILES | O=C2C1=C(N)C=C(Br)C(=O)C1=C(N)C=C2Br |
| InChI | 1S/C10H6Br2N2O2/c11-3-1-5(13)7-8(9(3)15)6(14)2-4(12)10(7)16/h1-2H,13-14H2 |
| InChIKey | RVVRUFFZGGPYGG-UHFFFAOYSA-N |
| Density | 2.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.062°C at 760 mmHg (Cal.) |
| Flash point | 160.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Diamino-2,6-Dibromo-1,5-Naphthoquinone |