Online Database of Chemicals from Around the World
|
CAS#: 73468-51-6 Product: 1,5-Diamino-2-Bromo-4,8-Dihydroxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,5-Diamino-2-Bromo-4,8-Dihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,5-Diamino-2-Bromo-4,8-Dihydroxy-Anthracene-9,10-Dione; 1,5-Diamino-2-Bromo-4,8-Dihydroxy-9,10-Anthraquinone; 1,5-Diaminobromo-4,8-Dihydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H9BrN2O4 |
| Molecular Weight | 349.14 |
| CAS Registry Number | 73468-51-6 (27312-17-0) |
| SMILES | C3=C(C1=C(C(C2=C(C1=O)C(=CC=C2O)N)=O)C(=C3Br)N)O |
| InChI | 1S/C14H9BrN2O4/c15-4-3-7(19)10-11(12(4)17)14(21)9-6(18)2-1-5(16)8(9)13(10)20/h1-3,18-19H,16-17H2 |
| InChIKey | HZUBBVGKQQJUME-UHFFFAOYSA-N |
| Density | 1.976g/cm3 (Cal.) |
|---|---|
| Boiling point | 679.05°C at 760 mmHg (Cal.) |
| Flash point | 364.477°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diamino-2-Bromo-4,8-Dihydroxyanthracene-9,10-Dione |