Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Food safety >> Dioxins, polychlorinated biphenyls, furans |
|---|---|
| Name | 2,3',4,5'-Tetrachlorobiphenyl |
| Synonyms | 1,1'-Biphenyl, 2,3',4,5'-Tetrachloro; Pcb 68; 2,3',4,5'-Tetrachlorobiphenyl |
| Molecular Structure |  |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.99 |
| CAS Registry Number | 73575-52-7 |
| SMILES | C2=C(C1=C(Cl)C=C(Cl)C=C1)C=C(Cl)C=C2Cl |
| InChI | 1S/C12H6Cl4/c13-8-1-2-11(12(16)6-8)7-3-9(14)5-10(15)4-7/h1-6H |
| InChIKey | KTTXLLZIBIDUCR-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.413°C at 760 mmHg (Cal.) |
| Flash point | 174.864°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3',4,5'-Tetrachlorobiphenyl |