Online Database of Chemicals from Around the World
|
CAS#: 7358-61-4 Product: 1,3,5-Trimethylbarbituric Acid No suppilers available for the product. |
| Name | 1,3,5-Trimethylbarbituric Acid |
|---|---|
| Synonyms | 1,3,5-Trimethylhexahydropyrimidine-2,4,6-Trione; 1,3,5-Trimethylbarbituric Acid; 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,3,5-Trimethyl- |
| Molecular Structure |  |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 |
| CAS Registry Number | 7358-61-4 |
| EINECS | 230-892-9 |
| SMILES | CN1C(N(C(C(C1=O)C)=O)C)=O |
| InChI | 1S/C7H10N2O3/c1-4-5(10)8(2)7(12)9(3)6(4)11/h4H,1-3H3 |
| InChIKey | OTSKHUNLOQPIGN-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 235.766°C at 760 mmHg (Cal.) |
| Flash point | 94.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trimethylbarbituric Acid |