Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (3S)-2-azabicyclo[2.2.2]octane-3-carboxylate |
|---|---|
| Synonyms | (S)-methyl 2-azabicyclo[2.2.2]octane-3-carboxylate |
| Molecular Structure | ![CAS#: 736111-77-6， Methyl (3S)-2-azabicyclo[2.2.2]octane-3-carboxylate](/moreStructures/736111-77-6.gif) |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 |
| CAS Registry Number | 736111-77-6 |
| SMILES | COC(=O)[C@@H]1C2CCC(N1)CC2 |
| InChI | 1S/C9H15NO2/c1-12-9(11)8-6-2-4-7(10-8)5-3-6/h6-8,10H,2-5H2,1H3/t6?,7?,8-/m0/s1 |
| InChIKey | ICCFVKYDGHSTCZ-RRQHEKLDSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.49°C at 760 mmHg (Cal.) |
| Flash point | 96.826°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (3S)-2-azabicyclo[2.2.2]octane-3-carboxylate |