Online Database of Chemicals from Around the World
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
 |
+91 (40) 6661-1133 | |||
 |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1-Ethyl-3-Nitrobenzene |
|---|---|
| Synonyms | 1-Ethyl-3-Nitro-Benzene; Benzene, 1-Ethyl-3-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 |
| CAS Registry Number | 7369-50-8 |
| EINECS | 230-923-6 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1CC |
| InChI | 1S/C8H9NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | RXAKLPGKSXJZEF-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.212°C at 760 mmHg (Cal.) |
| Flash point | 105.336°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-3-Nitrobenzene |