Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-(Aminomethyl)-1-isopropylcyclopropanecarboxylic acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 736915-21-2 |
| SMILES | CC(C)[C@@]1(C[C@H]1CN)C(=O)O |
| InChI | 1S/C8H15NO2/c1-5(2)8(7(10)11)3-6(8)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)/t6-,8+/m0/s1 |
| InChIKey | NPILJSZFVDDEFP-POYBYMJQSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.3±13.0°C at 760 mmHg (Cal.) |
| Flash point | 115.5±19.8°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-(Aminomethyl)-1-isopropylcyclopropanecarboxylic acid |