Online Database of Chemicals from Around the World
|
CAS#: 73698-57-4 Product: 2-Phenyl-1,3,2-Benzodiazaborole No suppilers available for the product. |
| Name | 2-Phenyl-1,3,2-Benzodiazaborole |
|---|---|
| Synonyms | 2H-1,3,2-Benzodiazaborole, 2-Phenyl-; 2-Phenyl-2H-1,3,2-Benzodiazaborole |
| Molecular Structure |  |
| Molecular Formula | C12H9BN2 |
| Molecular Weight | 192.03 |
| CAS Registry Number | 73698-57-4 |
| SMILES | C1=CC=CC=C1B2N=C3C(=N2)C=CC=C3 |
| InChI | 1S/C12H9BN2/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9H |
| InChIKey | JMBHJTURSCKZDZ-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.975°C at 760 mmHg (Cal.) |
| Flash point | 140.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-1,3,2-Benzodiazaborole |