Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | trans-1,3-Cyclobutanedicarbonyl dichloride |
|---|---|
| Synonyms | (1r,3r)-cyclobutane-1,3-dicarbonyl dichloride |
| Molecular Structure |  |
| Molecular Formula | C6H6Cl2O2 |
| Molecular Weight | 181.02 |
| CAS Registry Number | 7371-72-4 |
| SMILES | C1[C@@H](C[C@H]1C(=O)Cl)C(=O)Cl |
| InChI | 1S/C6H6Cl2O2/c7-5(9)3-1-4(2-3)6(8)10/h3-4H,1-2H2/t3-,4- |
| InChIKey | AKNSPOIOVXTGSF-JPYJGEKTSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.1±33.0°C at 760 mmHg (Cal.) |
| Flash point | 90.7±21.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-1,3-Cyclobutanedicarbonyl dichloride |