|
CAS#: 73758-52-8 Product: Ethyl 3-Amino-3-(Carbamoylamino)Butanoate No suppilers available for the product. |
| Name | Ethyl 3-Amino-3-(Carbamoylamino)Butanoate |
|---|---|
| Synonyms | Ethyl 3-Amino-3-Ureido-Butanoate; 3-Amino-3-Ureidobutanoic Acid Ethyl Ester; 3-Amino-3-Ureido-Butyric Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 73758-52-8 |
| EINECS | 277-587-7 |
| SMILES | C(C(NC(N)=O)(C)N)C(OCC)=O |
| InChI | 1S/C7H15N3O3/c1-3-13-5(11)4-7(2,9)10-6(8)12/h3-4,9H2,1-2H3,(H3,8,10,12) |
| InChIKey | USZCLVNQMQEOBA-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.123°C at 760 mmHg (Cal.) |
| Flash point | 149.219°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-Amino-3-(Carbamoylamino)Butanoate |