Online Database of Chemicals from Around the World
| Name | alpha-(Fluoromethyl)-5-Hydroxytryptophan |
|---|---|
| Synonyms | 2-Amino-2-(Fluoromethyl)-3-(5-Hydroxy-1H-Indol-3-Yl)Propionic Acid; Fm-Ohtrp; Alpha-(Fluoromethyl)-5-Hydroxytryptophan |
| Molecular Structure |  |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 |
| CAS Registry Number | 73804-78-1 |
| SMILES | C1=C(C2=C([NH]1)C=CC(=C2)O)CC(N)(C(=O)O)CF |
| InChI | 1S/C12H13FN2O3/c13-6-12(14,11(17)18)4-7-5-15-10-2-1-8(16)3-9(7)10/h1-3,5,15-16H,4,6,14H2,(H,17,18) |
| InChIKey | XWAHBYZGNVFLIE-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.376°C at 760 mmHg (Cal.) |
| Flash point | 284.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Fluoromethyl)-5-Hydroxytryptophan |
