Online Database of Chemicals from Around the World
|
CAS#: 73816-81-6 Product: 2-(Benzylsulfanyl)-3-chloro-1,4-naphthoquinone No suppilers available for the product. |
| Name | 2-(Benzylsulfanyl)-3-chloro-1,4-naphthoquinone |
|---|---|
| Synonyms | 1,4-Naphthalenedione, 2-chloro-3-((phenylmethyl)thio)- (9CI); 1,4-Naphthalenedione, 2-chloro-3-[ (phenylmethyl)thio]-; 1,4-Naphthoquinone, 2-benzylthio-3-chloro- |
| Molecular Structure |  |
| Molecular Formula | C17H11ClO2S |
| Molecular Weight | 314.79 |
| CAS Registry Number | 73816-81-6 |
| SMILES | O=C3c1c(cccc1)C(=O)C(/Cl)=C3/SCc2ccccc2 |
| InChI | 1S/C17H11ClO2S/c18-14-15(19)12-8-4-5-9-13(12)16(20)17(14)21-10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | MZJPVYZIMKYPCN-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.612°C at 760 mmHg (Cal.) |
| Flash point | 218.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Benzylsulfanyl)-3-chloro-1,4-naphthoquinone |