Online Database of Chemicals from Around the World
|
CAS#: 7384-07-8 Product: 3-Hydroxycarbazole No suppilers available for the product. |
| Name | 3-Hydroxycarbazole |
|---|---|
| Synonyms | 3-Hydroxycarbazole; Ccris 5302; Oprea1_818554 |
| Molecular Structure |  |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 |
| CAS Registry Number | 7384-07-8 |
| SMILES | C1=CC(=CC2=C1[NH]C3=C2C=CC=C3)O |
| InChI | 1S/C12H9NO/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)13-12/h1-7,13-14H |
| InChIKey | ZIKXHZSORLSPCO-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.387°C at 760 mmHg (Cal.) |
| Flash point | 214.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxycarbazole |