Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Ethyl-9H-carbazol-1-ol |
|---|---|
| Synonyms | 3-ethyl-9H-carbazol-1-ol |
| Molecular Structure |  |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 738608-37-2 |
| SMILES | CCc1cc2c3ccccc3[nH]c2c(c1)O |
| InChI | 1S/C14H13NO/c1-2-9-7-11-10-5-3-4-6-12(10)15-14(11)13(16)8-9/h3-8,15-16H,2H2,1H3 |
| InChIKey | WTECPTSPONOAOY-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.965°C at 760 mmHg (Cal.) |
| Flash point | 225.326°C (Cal.) |
| Refractive index | 1.745 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-9H-carbazol-1-ol |