Online Database of Chemicals from Around the World
|
CAS#: 73927-07-8 Product: 1-Iodo-4-(4-Iodophenyl)Sulfanylbenzene No suppilers available for the product. |
| Name | 1-Iodo-4-(4-Iodophenyl)Sulfanylbenzene |
|---|---|
| Synonyms | 1-Iodo-4-(4-Iodophenyl)Sulfanyl-Benzene; 1-Iodo-4-[(4-Iodophenyl)Thio]Benzene; 0-06-00-00335 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C12H8I2S |
| Molecular Weight | 438.06 |
| CAS Registry Number | 73927-07-8 |
| SMILES | C1=CC(=CC=C1SC2=CC=C(C=C2)I)I |
| InChI | 1S/C12H8I2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | DUVVOUSAQUQNMU-UHFFFAOYSA-N |
| Density | 2.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.951°C at 760 mmHg (Cal.) |
| Flash point | 221.084°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Iodo-4-(4-Iodophenyl)Sulfanylbenzene |