Online Database of Chemicals from Around the World
| Name | 1-(2-Chlorocyclohexyl)Sulfanyl-3-Nitrobenzene |
|---|---|
| Synonyms | 1-(2-Chlorocyclohexyl)Sulfanyl-3-Nitro-Benzene; 1-[(2-Chlorocyclohexyl)Thio]-3-Nitrobenzene; 1-[(2-Chlorocyclohexyl)Thio]-3-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.76 |
| CAS Registry Number | 73927-08-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1SC2C(Cl)CCCC2 |
| InChI | 1S/C12H14ClNO2S/c13-11-6-1-2-7-12(11)17-10-5-3-4-9(8-10)14(15)16/h3-5,8,11-12H,1-2,6-7H2 |
| InChIKey | VGGJONRPYFOQNS-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.692°C at 760 mmHg (Cal.) |
| Flash point | 197.341°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorocyclohexyl)Sulfanyl-3-Nitrobenzene |
