Online Database of Chemicals from Around the World
|
CAS#: 73927-23-8 Product: 2-Anilinoethanol Hydroiodide No suppilers available for the product. |
| Name | 2-Anilinoethanol Hydroiodide |
|---|---|
| Synonyms | 2-Phenylazanylethanol Hydroiodide; Ethanol, 2-Anilino-, Hydriodide |
| Molecular Structure |  |
| Molecular Formula | C8H12INO |
| Molecular Weight | 265.09 |
| CAS Registry Number | 73927-23-8 |
| SMILES | [H+].C1=C(NCCO)C=CC=C1.[I-] |
| InChI | 1S/C8H11NO.HI/c10-7-6-9-8-4-2-1-3-5-8;/h1-5,9-10H,6-7H2;1H |
| InChIKey | PUEZMPAMLKWYOS-UHFFFAOYSA-N |
| Boiling point | 286.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Anilinoethanol Hydroiodide |