Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (440) 337-1200 | |||
|
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | 2,2',6,6'-Tetrachlorodibenzylether |
|---|---|
| Synonyms | 1,3-Dichloro-2-[(2,6-Dichlorobenzyl)Oxymethyl]Benzene; 2,6-Dichlorobenzyl Ether; Brn 4262749 |
| Molecular Structure |  |
| Molecular Formula | C14H10Cl4O |
| Molecular Weight | 336.04 |
| CAS Registry Number | 73927-56-7 |
| SMILES | C1=C(C(=C(C=C1)Cl)COCC2=C(C=CC=C2Cl)Cl)Cl |
| InChI | 1S/C14H10Cl4O/c15-11-3-1-4-12(16)9(11)7-19-8-10-13(17)5-2-6-14(10)18/h1-6H,7-8H2 |
| InChIKey | ITFCEERPJPLHPQ-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.902°C at 760 mmHg (Cal.) |
| Flash point | 139.715°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2',6,6'-Tetrachlorodibenzylether |