Online Database of Chemicals from Around the World
|
CAS#: 73928-04-8 Product: 3-Methyl-4-Stilbenamine No suppilers available for the product. |
| Name | 3-Methyl-4-Stilbenamine |
|---|---|
| Synonyms | 2-Methyl-4-[(E)-2-Phenylvinyl]Aniline; [2-Methyl-4-[(E)-2-Phenylvinyl]Phenyl]Amine; 3-Methyl-4-Stilbenamine |
| Molecular Structure |  |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 |
| CAS Registry Number | 73928-04-8 |
| SMILES | C1=C(C(=CC=C1\C=C\C2=CC=CC=C2)N)C |
| InChI | 1S/C15H15N/c1-12-11-14(9-10-15(12)16)8-7-13-5-3-2-4-6-13/h2-11H,16H2,1H3/b8-7+ |
| InChIKey | DIUWMHRBWCFTSX-BQYQJAHWSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.695°C at 760 mmHg (Cal.) |
| Flash point | 190.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-Stilbenamine |