Online Database of Chemicals from Around the World
|
CAS#: 73932-55-5 Product: alpha-(4-Bromo-2,3,5,6-Tetramethylphenyl)-1H-Imidazole-1-Ethanol No suppilers available for the product. |
| Name | alpha-(4-Bromo-2,3,5,6-Tetramethylphenyl)-1H-Imidazole-1-Ethanol |
|---|---|
| Synonyms | 1-(4-Bromo-2,3,5,6-Tetramethyl-Phenyl)-2-Imidazol-1-Yl-Ethanol; 1-(4-Bromo-2,3,5,6-Tetramethylphenyl)-2-(1-Imidazolyl)Ethanol; 1H-Imidazole-1-Ethanol, Alpha-(4-Bromo-2,3,5,6-Tetramethylphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 |
| CAS Registry Number | 73932-55-5 |
| SMILES | C1=NC=C[N]1CC(O)C2=C(C(=C(C(=C2C)C)Br)C)C |
| InChI | 1S/C15H19BrN2O/c1-9-11(3)15(16)12(4)10(2)14(9)13(19)7-18-6-5-17-8-18/h5-6,8,13,19H,7H2,1-4H3 |
| InChIKey | YEBGGVIFUPJPGG-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.758°C at 760 mmHg (Cal.) |
| Flash point | 263.907°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(4-Bromo-2,3,5,6-Tetramethylphenyl)-1H-Imidazole-1-Ethanol |