Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 6-(2-Methylphenoxy)-7H-Purine |
|---|---|
| Synonyms | Nsc 29926; 1H-Purine, 6-(2-Methylphenoxy)- (9Ci); 1H-Purine, 6-(2-Methylphenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 |
| CAS Registry Number | 73972-55-1 |
| SMILES | C3=NC1=C(C(=NC=N1)OC2=CC=CC=C2C)[NH]3 |
| InChI | 1S/C12H10N4O/c1-8-4-2-3-5-9(8)17-12-10-11(14-6-13-10)15-7-16-12/h2-7H,1H3,(H,13,14,15,16) |
| InChIKey | LVYGUKJPQKOPQG-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.471°C at 760 mmHg (Cal.) |
| Flash point | 169.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Methylphenoxy)-7H-Purine |