Online Database of Chemicals from Around the World
|
CAS#: 73972-63-1 Product: 3-Chloro-5-(Dichloromethyl)-2-Methoxypyrazine No suppilers available for the product. |
| Name | 3-Chloro-5-(Dichloromethyl)-2-Methoxypyrazine |
|---|---|
| Synonyms | 3-Chloro-5-(Dichloromethyl)-2-Methoxy-Pyrazine; Pyrazine, 3-Chloro-5-(Dichloromethyl)-2-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C6H5Cl3N2O |
| Molecular Weight | 227.48 |
| CAS Registry Number | 73972-63-1 |
| SMILES | C1=C(N=C(C(=N1)OC)Cl)C(Cl)Cl |
| InChI | 1S/C6H5Cl3N2O/c1-12-6-5(9)11-3(2-10-6)4(7)8/h2,4H,1H3 |
| InChIKey | QMGUSHIZVYNVKJ-UHFFFAOYSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.132°C at 760 mmHg (Cal.) |
| Flash point | 125.034°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-5-(Dichloromethyl)-2-Methoxypyrazine |