Online Database of Chemicals from Around the World
|
CAS#: 73986-95-5 Product: 1-(2,4-Dichlorophenoxy)Ethane-1,2-Diol No suppilers available for the product. |
| Name | 1-(2,4-Dichlorophenoxy)Ethane-1,2-Diol |
|---|---|
| Synonyms | 1,2-Ethanediol, 2,4-Dichlorophenoxy-; 2,4-Dichlorophenoxy Ethanediol |
| Molecular Structure |  |
| Molecular Formula | C8H8Cl2O3 |
| Molecular Weight | 223.06 |
| CAS Registry Number | 73986-95-5 |
| SMILES | C1=C(C(=CC=C1Cl)OC(CO)O)Cl |
| InChI | 1S/C8H8Cl2O3/c9-5-1-2-7(6(10)3-5)13-8(12)4-11/h1-3,8,11-12H,4H2 |
| InChIKey | HMJHOMSWBBBOJV-UHFFFAOYSA-N |
| Density | 1.495g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.778°C at 760 mmHg (Cal.) |
| Flash point | 193.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dichlorophenoxy)Ethane-1,2-Diol |