Online Database of Chemicals from Around the World
|
CAS#: 73987-35-6 Product: 3,4-Dichloroquinolin-2-Amine No suppilers available for the product. |
| Name | 3,4-Dichloroquinolin-2-Amine |
|---|---|
| Synonyms | 3,4-Dichloro-2-Quinolinamine; (3,4-Dichloro-2-Quinolyl)Amine; 2-Amino-3,4-Dichloroquinoline |
| Molecular Structure |  |
| Molecular Formula | C9H6Cl2N2 |
| Molecular Weight | 213.07 |
| CAS Registry Number | 73987-35-6 |
| SMILES | C2=C1C(=C(C(=NC1=CC=C2)N)Cl)Cl |
| InChI | 1S/C9H6Cl2N2/c10-7-5-3-1-2-4-6(5)13-9(12)8(7)11/h1-4H,(H2,12,13) |
| InChIKey | TZFJDFLGRAVDCT-UHFFFAOYSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.732°C at 760 mmHg (Cal.) |
| Flash point | 151.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dichloroquinolin-2-Amine |