Online Database of Chemicals from Around the World
|
CAS#: 74163-66-9 Product: 2-Chloro-1,1,1,2,3,4,4,4-octafluorobutane No suppilers available for the product. |
| Name | 2-Chloro-1,1,1,2,3,4,4,4-octafluorobutane |
|---|---|
| Synonyms | 2-chloro-1,1,1,2,3,4,4,4-octafluorobutane |
| Molecular Structure |  |
| Molecular Formula | C4HClF8 |
| Molecular Weight | 236.49 |
| CAS Registry Number | 74163-66-9 |
| SMILES | FC(C(Cl)(F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C4HClF8/c5-2(7,4(11,12)13)1(6)3(8,9)10/h1H |
| InChIKey | DGROXNFZUHBKQR-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 44.919°C at 760 mmHg (Cal.) |
| Flash point | -14.409°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,1,1,2,3,4,4,4-octafluorobutane |