Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-(Chlorocarbonyl)cyclopropanecarboxylic acid |
|---|---|
| Synonyms | (1R,2R)-2-(chlorocarbonyl)cyclopropanecarboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C5H5ClO3 |
| Molecular Weight | 148.54 |
| CAS Registry Number | 74177-20-1 |
| SMILES | C1[C@H]([C@@H]1C(=O)Cl)C(=O)O |
| InChI | 1S/C5H5ClO3/c6-4(7)2-1-3(2)5(8)9/h2-3H,1H2,(H,8,9)/t2-,3-/m1/s1 |
| InChIKey | FATPGDVSKWCEGI-PWNYCUMCSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.985°C at 760 mmHg (Cal.) |
| Flash point | 118.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-(Chlorocarbonyl)cyclopropanecarboxylic acid |