| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2,2-Bis(4-Oxocyclohexyl)Propane |
|---|---|
| Synonyms | 4-[1-Methyl-1-(4-Oxocyclohexyl)Ethyl]Cyclohexan-1-One; 4-[1-Methyl-1-(4-Oxocyclohexyl)Ethyl]-1-Cyclohexanone; 4-[1-(4-Ketocyclohexyl)-1-Methyl-Ethyl]Cyclohexan-1-One |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 |
| CAS Registry Number | 7418-16-8 |
| EINECS | 231-035-1 |
| SMILES | C2(C(C1CCC(=O)CC1)(C)C)CCC(=O)CC2 |
| InChI | 1S/C15H24O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | HAWVCXABNZBPED-UHFFFAOYSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Melting point | 164°C (Expl.) |
| Boiling point | 358.297°C at 760 mmHg (Cal.) |
| Flash point | 134.438°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis(4-Oxocyclohexyl)Propane |