| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | 2-Ethyl-Hexanoic Acid 2-Ethylhexyl Ester |
|---|---|
| Synonyms | 2-Ethylhexanoic Acid 2-Ethylhexyl Ester; 2-Ethylhexanoic Acid, 2-Ethylhexyl Ester; 2-Ethylhexyl-2-Ethylhexanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 |
| CAS Registry Number | 7425-14-1 |
| EINECS | 231-057-1 |
| SMILES | C(C(C(OCC(CCCC)CC)=O)CC)CCC |
| InChI | 1S/C16H32O2/c1-5-9-11-14(7-3)13-18-16(17)15(8-4)12-10-6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | OUCGJMIVSYHBEC-UHFFFAOYSA-N |
| Density | 0.864g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.271°C at 760 mmHg (Cal.) |
| Flash point | 137.076°C (Cal.) |
| (1) | Hassan S. Ghaziaskar, Ali Daneshfar and Lourdes Calvo. Continuous esterification or dehydration in supercritical carbon dioxide, Green Chem., 2006, 8, 576. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-Hexanoic Acid 2-Ethylhexyl Ester |